C7H10BrNO2S2 — CID 117192612
2-bromo-5-(propan-2-ylsulfonylmethyl)-1,3-thiazole (PubChem CID 117192612) has the molecular formula C7H10BrNO2S2 and a molecular weight of 284.20 g/mol. Its IUPAC name is 2-bromo-5-(propan-2-ylsulfonylmethyl)-1,3-thiazole.
| Compound Name | 2-bromo-5-(propan-2-ylsulfonylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 117192612 |
| Molecular Formula | C7H10BrNO2S2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 2-bromo-5-(propan-2-ylsulfonylmethyl)-1,3-thiazole |
| SMILES | CC(C)S(=O)(=O)Cc1cnc(Br)s1 |
| InChI | InChI=1S/C7H10BrNO2S2/c1-5(2)13(10,11)4-6-3-9-7(8)12-6/h3,5H,4H2,1-2H3 |
| InChIKey | QXBWXNUEDLZTRH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |