C24H19ClN4O3 — CID 11719279
2-[7-chloro-5-[[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid (PubChem CID 11719279) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is 2-[7-chloro-5-[[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid.
| Compound Name | 2-[7-chloro-5-[[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid |
|---|---|
| PubChem CID | 11719279 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[7-chloro-5-[[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid |
| SMILES | O=C(O)Cc1c(Cl)nc(Cc2ccc(NC(=O)/C=C/c3ccccc3)cc2)n2ccnc12 |
| InChI | InChI=1S/C24H19ClN4O3/c25-23-19(15-22(31)32)24-26-12-13-29(24)20(28-23)14-17-6-9-18(10-7-17)27-21(30)11-8-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,27,30)(H,31,32)/b11-8+ |
| InChIKey | YWPDTUDVAQMTCU-DHZHZOJOSA-N |
| XLogP | 4.25 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|