methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate

C13H16BrNO2 — CID 117193468

IUPACmethyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate
SMILESCCC1(C(=O)OC)CCc2ccc(Br)cc2N1
InChIInChI=1S/C13H16BrNO2/c1-3-13(12(16)17-2)7-6-9-4-5-10(14)8-11(9)15-13/h4-5,8,15H,3,6-7H2,1-2H3
InChIKeySQDXUVQUCRLLLO-UHFFFAOYSA-N
MW298.18 g/mol
LogP3.13
Rot. Bonds2

About methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate

methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate (PubChem CID 117193468) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate
PubChem CID117193468
Molecular FormulaC13H16BrNO2
Molecular Weight298.18 g/mol
Exact Mass297.04
IUPAC Namemethyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate
SMILESCCC1(C(=O)OC)CCc2ccc(Br)cc2N1
InChIInChI=1S/C13H16BrNO2/c1-3-13(12(16)17-2)7-6-9-4-5-10(14)8-11(9)15-13/h4-5,8,15H,3,6-7H2,1-2H3
InChIKeySQDXUVQUCRLLLO-UHFFFAOYSA-N
XLogP3.13
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.18
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The IUPAC name of methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate (CID 117193468) is methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate.
What is the SMILES notation for methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The canonical SMILES for methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate is CCC1(C(=O)OC)CCc2ccc(Br)cc2N1.
What is the InChIKey of methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The InChIKey is SQDXUVQUCRLLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-3-13(12(16)17-2)7-6-9-4-5-10(14)8-11(9)15-13/h4-5,8,15H,3,6-7H2,1-2H3.
What are the key properties of methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate?
methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate has a molecular weight of 298.18 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-bromo-2-ethyl-3,4-dihydro-1H-quinoline-2-carboxylate is sourced from PubChem (CID 117193468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).