C12H17N — CID 117193754
2,2,3,5-tetramethyl-1,3-dihydroindole (PubChem CID 117193754) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 2,2,3,5-tetramethyl-1,3-dihydroindole.
| Compound Name | 2,2,3,5-tetramethyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 117193754 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2,2,3,5-tetramethyl-1,3-dihydroindole |
| SMILES | Cc1ccc2c(c1)C(C)C(C)(C)N2 |
| InChI | InChI=1S/C12H17N/c1-8-5-6-11-10(7-8)9(2)12(3,4)13-11/h5-7,9,13H,1-4H3 |
| InChIKey | ICLGPMOAYPRYRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |