About 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol
2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol (PubChem CID 117193943) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol.
Molecular Properties
| Compound Name | 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol |
| PubChem CID | 117193943 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol |
| SMILES | CCC1(C)CC(C)c2cccc(O)c2N1 |
| InChI | InChI=1S/C13H19NO/c1-4-13(3)8-9(2)10-6-5-7-11(15)12(10)14-13/h5-7,9,14-15H,4,8H2,1-3H3 |
| InChIKey | KCWVDWQFGYOTTA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol?
The IUPAC name of 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol (CID 117193943) is 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol.
What is the SMILES notation for 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol?
The canonical SMILES for 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol is CCC1(C)CC(C)c2cccc(O)c2N1.
What is the InChIKey of 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol?
The InChIKey is KCWVDWQFGYOTTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-4-13(3)8-9(2)10-6-5-7-11(15)12(10)14-13/h5-7,9,14-15H,4,8H2,1-3H3.
What are the key properties of 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol?
2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol has a molecular weight of 205.30 g/mol, XLogP of 3.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,4-dimethyl-3,4-dihydro-1H-quinolin-8-ol is sourced from PubChem (CID 117193943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).