C13H14ClNO2 — CID 117194104
3-(2-chlorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 117194104) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3-(2-chlorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 117194104 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(2-chlorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(N2)C1c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClNO2/c14-8-4-2-1-3-7(8)11-9-5-6-10(15-9)12(11)13(16)17/h1-4,9-12,15H,5-6H2,(H,16,17) |
| InChIKey | XDOXQQGIGOVYDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |