C16H24N2 — CID 117195171
N-methyl-1-(5-methyl-1-propan-2-ylindol-2-yl)propan-2-amine (PubChem CID 117195171) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-methyl-1-(5-methyl-1-propan-2-ylindol-2-yl)propan-2-amine.
| Compound Name | N-methyl-1-(5-methyl-1-propan-2-ylindol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 117195171 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-methyl-1-(5-methyl-1-propan-2-ylindol-2-yl)propan-2-amine |
| SMILES | CNC(C)Cc1cc2cc(C)ccc2n1C(C)C |
| InChI | InChI=1S/C16H24N2/c1-11(2)18-15(9-13(4)17-5)10-14-8-12(3)6-7-16(14)18/h6-8,10-11,13,17H,9H2,1-5H3 |
| InChIKey | YGFITLRUAUIBKB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |