C10H11FN2O — CID 117195230
O-[(5-fluoro-1-methylindol-2-yl)methyl]hydroxylamine (PubChem CID 117195230) has the molecular formula C10H11FN2O and a molecular weight of 194.21 g/mol. Its IUPAC name is O-[(5-fluoro-1-methylindol-2-yl)methyl]hydroxylamine.
| Compound Name | O-[(5-fluoro-1-methylindol-2-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117195230 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | O-[(5-fluoro-1-methylindol-2-yl)methyl]hydroxylamine |
| SMILES | Cn1c(CON)cc2cc(F)ccc21 |
| InChI | InChI=1S/C10H11FN2O/c1-13-9(6-14-12)5-7-4-8(11)2-3-10(7)13/h2-5H,6,12H2,1H3 |
| InChIKey | LSZLHXUXMVVIHE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|