C13H15NO3 — CID 117195358
3-(5-hydroxy-1H-indol-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 117195358) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(5-hydroxy-1H-indol-2-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-hydroxy-1H-indol-2-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117195358 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(5-hydroxy-1H-indol-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1cc2cc(O)ccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C13H15NO3/c1-13(2,12(16)17)7-9-5-8-6-10(15)3-4-11(8)14-9/h3-6,14-15H,7H2,1-2H3,(H,16,17) |
| InChIKey | IHUJVJZEDWJWLE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |