C15H19F3N2 — CID 117195467
3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-N-methylpropan-1-amine (PubChem CID 117195467) has the molecular formula C15H19F3N2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 117195467 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[1-ethyl-5-(trifluoromethyl)indol-3-yl]-N-methylpropan-1-amine |
| SMILES | CCn1cc(CCCNC)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H19F3N2/c1-3-20-10-11(5-4-8-19-2)13-9-12(15(16,17)18)6-7-14(13)20/h6-7,9-10,19H,3-5,8H2,1-2H3 |
| InChIKey | BIBJWHNJNCYPKL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|