C32H24N4 — CID 11719635
5,15-diphenyl-2,3,22,24-tetrahydroporphyrin (PubChem CID 11719635) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 5,15-diphenyl-2,3,22,24-tetrahydroporphyrin.
| Compound Name | 5,15-diphenyl-2,3,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 11719635 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 5,15-diphenyl-2,3,22,24-tetrahydroporphyrin |
| SMILES | C1=Cc2nc1cc1ccc([nH]1)c(-c1ccccc1)c1nc(cc3ccc([nH]3)c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C32H24N4/c1-3-7-21(8-4-1)31-27-15-11-23(33-27)19-25-13-17-29(35-25)32(22-9-5-2-6-10-22)30-18-14-26(36-30)20-24-12-16-28(31)34-24/h1-13,15-17,19-20,34-35H,14,18H2/b23-19-,24-20-,25-19-,26-20-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | JJJHZIGMMVUPBP-DUVOQLPESA-N |
| XLogP | 7.60 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |