C27H23N5O3 — CID 11719649
N-(5-benzyl-1H-1,2,4-triazol-3-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 11719649) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-(5-benzyl-1H-1,2,4-triazol-3-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-(5-benzyl-1H-1,2,4-triazol-3-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 11719649 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(5-benzyl-1H-1,2,4-triazol-3-yl)-15-methyl-8-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2n[nH]c(Cc3ccccc3)n2)CC2([N+](=O)[O-])c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C27H23N5O3/c1-26(24(33)29-25-28-22(30-31-25)15-17-9-3-2-4-10-17)16-27(32(34)35)20-13-7-5-11-18(20)23(26)19-12-6-8-14-21(19)27/h2-14,23H,15-16H2,1H3,(H2,28,29,30,31,33) |
| InChIKey | FOUWMIUBSOYBPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|