C12H12F3NS — CID 117196527
3-[7-(trifluoromethyl)-1-benzothiophen-2-yl]propan-1-amine (PubChem CID 117196527) has the molecular formula C12H12F3NS and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-[7-(trifluoromethyl)-1-benzothiophen-2-yl]propan-1-amine.
| Compound Name | 3-[7-(trifluoromethyl)-1-benzothiophen-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 117196527 |
| Molecular Formula | C12H12F3NS |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3-[7-(trifluoromethyl)-1-benzothiophen-2-yl]propan-1-amine |
| SMILES | NCCCc1cc2cccc(C(F)(F)F)c2s1 |
| InChI | InChI=1S/C12H12F3NS/c13-12(14,15)10-5-1-3-8-7-9(4-2-6-16)17-11(8)10/h1,3,5,7H,2,4,6,16H2 |
| InChIKey | XYJYVPCUIAEOAK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |