C14H14F3NO2 — CID 117196565
2-methyl-2-[1-methyl-7-(trifluoromethyl)indol-2-yl]propanoic acid (PubChem CID 117196565) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-methyl-2-[1-methyl-7-(trifluoromethyl)indol-2-yl]propanoic acid.
| Compound Name | 2-methyl-2-[1-methyl-7-(trifluoromethyl)indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 117196565 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-methyl-2-[1-methyl-7-(trifluoromethyl)indol-2-yl]propanoic acid |
| SMILES | Cn1c(C(C)(C)C(=O)O)cc2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C14H14F3NO2/c1-13(2,12(19)20)10-7-8-5-4-6-9(14(15,16)17)11(8)18(10)3/h4-7H,1-3H3,(H,19,20) |
| InChIKey | AHNDVRJOWWIOML-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |