About 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine
2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine (PubChem CID 117196774) has the molecular formula C10H10BrNO2S
and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine |
| PubChem CID | 117196774 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine |
| SMILES | NCCC1=Cc2cccc(Br)c2S1(=O)=O |
| InChI | InChI=1S/C10H10BrNO2S/c11-9-3-1-2-7-6-8(4-5-12)15(13,14)10(7)9/h1-3,6H,4-5,12H2 |
| InChIKey | JSQZTKKLHDWKEA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine?
The IUPAC name of 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine (CID 117196774) is 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine.
What is the SMILES notation for 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine?
The canonical SMILES for 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine is NCCC1=Cc2cccc(Br)c2S1(=O)=O.
What is the InChIKey of 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine?
The InChIKey is JSQZTKKLHDWKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2S/c11-9-3-1-2-7-6-8(4-5-12)15(13,14)10(7)9/h1-3,6H,4-5,12H2.
What are the key properties of 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine?
2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine has a molecular weight of 288.17 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-1,1-dioxo-1-benzothiophen-2-yl)ethanamine is sourced from PubChem (CID 117196774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).