C27H48O6 — CID 11719714
propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 11719714) has the molecular formula C27H48O6 and a molecular weight of 468.68 g/mol. Its IUPAC name is propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11719714 |
| Molecular Formula | C27H48O6 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@@H]2[C@@H](C/C=C/CCCC(=O)OC(C)C)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C27H48O6/c1-4-5-6-9-12-16-27(31-18-19-32-27)17-15-23-22(24(28)20-25(23)29)13-10-7-8-11-14-26(30)33-21(2)3/h7,10,21-25,28-29H,4-6,8-9,11-20H2,1-3H3/b10-7+/t22-,23-,24+,25-/m1/s1 |
| InChIKey | FCDDMESBMCWDJP-PEEJLGBMSA-N |
| XLogP | 5.30 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|