C24H46O5Si2 — CID 11719757
methyl (E,2S,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-methylidene-9-oxo-3-triethylsilyloxynon-4-enoate (PubChem CID 11719757) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is methyl (E,2S,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-methylidene-9-oxo-3-triethylsilyloxynon-4-enoate.
| Compound Name | methyl (E,2S,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-methylidene-9-oxo-3-triethylsilyloxynon-4-enoate |
|---|---|
| PubChem CID | 11719757 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl (E,2S,3R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-methylidene-9-oxo-3-triethylsilyloxynon-4-enoate |
| SMILES | C=C(/C=C/[C@@H](O[Si](CC)(CC)CC)[C@H](C)C(=O)OC)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O5Si2/c1-12-31(13-2,14-3)29-22(20(5)23(26)27-9)16-15-19(4)21(17-18-25)28-30(10,11)24(6,7)8/h15-16,18,20-22H,4,12-14,17H2,1-3,5-11H3/b16-15+/t20-,21-,22+/m0/s1 |
| InChIKey | VMHSTUMPEXGFOH-ZJQNQJPSSA-N |
| XLogP | 6.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|