About 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol
2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol (PubChem CID 117198453) has the molecular formula C10H11FO3S
and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol |
| PubChem CID | 117198453 |
| Molecular Formula | C10H11FO3S |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol |
| SMILES | O=S1(=O)c2cccc(F)c2CC1CCO |
| InChI | InChI=1S/C10H11FO3S/c11-9-2-1-3-10-8(9)6-7(4-5-12)15(10,13)14/h1-3,7,12H,4-6H2 |
| InChIKey | STGNOMJGLAEGDO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol?
The IUPAC name of 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol (CID 117198453) is 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol.
What is the SMILES notation for 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol?
The canonical SMILES for 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol is O=S1(=O)c2cccc(F)c2CC1CCO.
What is the InChIKey of 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol?
The InChIKey is STGNOMJGLAEGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO3S/c11-9-2-1-3-10-8(9)6-7(4-5-12)15(10,13)14/h1-3,7,12H,4-6H2.
What are the key properties of 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol?
2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol has a molecular weight of 230.26 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-1,1-dioxo-2,3-dihydro-1-benzothiophen-2-yl)ethanol is sourced from PubChem (CID 117198453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).