About 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine
3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine (PubChem CID 117198579) has the molecular formula C11H14ClNS
and a molecular weight of 227.76 g/mol. Its IUPAC name is 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine |
| PubChem CID | 117198579 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine |
| SMILES | NCCCC1Cc2c(Cl)cccc2S1 |
| InChI | InChI=1S/C11H14ClNS/c12-10-4-1-5-11-9(10)7-8(14-11)3-2-6-13/h1,4-5,8H,2-3,6-7,13H2 |
| InChIKey | KNRYLGMQVNXBPB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine?
The IUPAC name of 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine (CID 117198579) is 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine.
What is the SMILES notation for 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine?
The canonical SMILES for 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine is NCCCC1Cc2c(Cl)cccc2S1.
What is the InChIKey of 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine?
The InChIKey is KNRYLGMQVNXBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNS/c12-10-4-1-5-11-9(10)7-8(14-11)3-2-6-13/h1,4-5,8H,2-3,6-7,13H2.
What are the key properties of 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine?
3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine has a molecular weight of 227.76 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,3-dihydro-1-benzothiophen-2-yl)propan-1-amine is sourced from PubChem (CID 117198579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).