About 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol
2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol (PubChem CID 117198983) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol.
Molecular Properties
| Compound Name | 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol |
| PubChem CID | 117198983 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol |
| SMILES | CC(O)CC1Cc2c(O)cccc2S1 |
| InChI | InChI=1S/C11H14O2S/c1-7(12)5-8-6-9-10(13)3-2-4-11(9)14-8/h2-4,7-8,12-13H,5-6H2,1H3 |
| InChIKey | HRPGDLBGTUGICH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol?
The IUPAC name of 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol (CID 117198983) is 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol.
What is the SMILES notation for 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol?
The canonical SMILES for 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol is CC(O)CC1Cc2c(O)cccc2S1.
What is the InChIKey of 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol?
The InChIKey is HRPGDLBGTUGICH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-7(12)5-8-6-9-10(13)3-2-4-11(9)14-8/h2-4,7-8,12-13H,5-6H2,1H3.
What are the key properties of 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol?
2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol has a molecular weight of 210.30 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxypropyl)-2,3-dihydro-1-benzothiophen-4-ol is sourced from PubChem (CID 117198983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).