About 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde
1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde (PubChem CID 117199416) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde.
Molecular Properties
| Compound Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde |
| PubChem CID | 117199416 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde |
| SMILES | O=CC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H8O3S/c10-5-7-6-13(11,12)9-4-2-1-3-8(7)9/h1-5,7H,6H2 |
| InChIKey | KVRYITWMVVWYMC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde?
The IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde (CID 117199416) is 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde.
What is the SMILES notation for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde?
The canonical SMILES for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde is O=CC1CS(=O)(=O)c2ccccc21.
What is the InChIKey of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde?
The InChIKey is KVRYITWMVVWYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-5-7-6-13(11,12)9-4-2-1-3-8(7)9/h1-5,7H,6H2.
What are the key properties of 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde?
1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde has a molecular weight of 196.23 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carbaldehyde is sourced from PubChem (CID 117199416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).