C10H9BrOS — CID 117199804
2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)acetaldehyde (PubChem CID 117199804) has the molecular formula C10H9BrOS and a molecular weight of 257.15 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)acetaldehyde.
| Compound Name | 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 117199804 |
| Molecular Formula | C10H9BrOS |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)acetaldehyde |
| SMILES | O=CCC1CSc2cccc(Br)c21 |
| InChI | InChI=1S/C10H9BrOS/c11-8-2-1-3-9-10(8)7(4-5-12)6-13-9/h1-3,5,7H,4,6H2 |
| InChIKey | UMHDTPICSGOXQL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|