About 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol
1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol (PubChem CID 117199812) has the molecular formula C10H11FOS
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol |
| PubChem CID | 117199812 |
| Molecular Formula | C10H11FOS |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol |
| SMILES | CC(O)C1CSc2cccc(F)c21 |
| InChI | InChI=1S/C10H11FOS/c1-6(12)7-5-13-9-4-2-3-8(11)10(7)9/h2-4,6-7,12H,5H2,1H3 |
| InChIKey | RTWRYFUKGVMHRO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol?
The IUPAC name of 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol (CID 117199812) is 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol.
What is the SMILES notation for 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol?
The canonical SMILES for 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol is CC(O)C1CSc2cccc(F)c21.
What is the InChIKey of 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol?
The InChIKey is RTWRYFUKGVMHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FOS/c1-6(12)7-5-13-9-4-2-3-8(11)10(7)9/h2-4,6-7,12H,5H2,1H3.
What are the key properties of 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol?
1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol has a molecular weight of 198.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol is sourced from PubChem (CID 117199812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).