About 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine
2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine (PubChem CID 117199847) has the molecular formula C10H12BrNS
and a molecular weight of 258.18 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine |
| PubChem CID | 117199847 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine |
| SMILES | NCCC1CSc2cccc(Br)c21 |
| InChI | InChI=1S/C10H12BrNS/c11-8-2-1-3-9-10(8)7(4-5-12)6-13-9/h1-3,7H,4-6,12H2 |
| InChIKey | FFOBOQVLBJJHKT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine?
The IUPAC name of 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine (CID 117199847) is 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine.
What is the SMILES notation for 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine?
The canonical SMILES for 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine is NCCC1CSc2cccc(Br)c21.
What is the InChIKey of 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine?
The InChIKey is FFOBOQVLBJJHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNS/c11-8-2-1-3-9-10(8)7(4-5-12)6-13-9/h1-3,7H,4-6,12H2.
What are the key properties of 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine?
2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine has a molecular weight of 258.18 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2,3-dihydro-1-benzothiophen-3-yl)ethanamine is sourced from PubChem (CID 117199847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).