C10H10FNO — CID 117199903
4-fluoro-1-methyl-2,3-dihydroindole-3-carbaldehyde (PubChem CID 117199903) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 4-fluoro-1-methyl-2,3-dihydroindole-3-carbaldehyde.
| Compound Name | 4-fluoro-1-methyl-2,3-dihydroindole-3-carbaldehyde |
|---|---|
| PubChem CID | 117199903 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-fluoro-1-methyl-2,3-dihydroindole-3-carbaldehyde |
| SMILES | CN1CC(C=O)c2c(F)cccc21 |
| InChI | InChI=1S/C10H10FNO/c1-12-5-7(6-13)10-8(11)3-2-4-9(10)12/h2-4,6-7H,5H2,1H3 |
| InChIKey | CQPIDGFJZLDRJJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|