C11H12ClNO — CID 117199908
1-(4-chloro-1-methyl-2,3-dihydroindol-3-yl)ethanone (PubChem CID 117199908) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 1-(4-chloro-1-methyl-2,3-dihydroindol-3-yl)ethanone.
| Compound Name | 1-(4-chloro-1-methyl-2,3-dihydroindol-3-yl)ethanone |
|---|---|
| PubChem CID | 117199908 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 1-(4-chloro-1-methyl-2,3-dihydroindol-3-yl)ethanone |
| SMILES | CC(=O)C1CN(C)c2cccc(Cl)c21 |
| InChI | InChI=1S/C11H12ClNO/c1-7(14)8-6-13(2)10-5-3-4-9(12)11(8)10/h3-5,8H,6H2,1-2H3 |
| InChIKey | USBFHAGXJLMQLI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |