C10H13FN2O — CID 117199932
O-[(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)methyl]hydroxylamine (PubChem CID 117199932) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is O-[(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117199932 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | O-[(4-fluoro-1-methyl-2,3-dihydroindol-3-yl)methyl]hydroxylamine |
| SMILES | CN1CC(CON)c2c(F)cccc21 |
| InChI | InChI=1S/C10H13FN2O/c1-13-5-7(6-14-12)10-8(11)3-2-4-9(10)13/h2-4,7H,5-6,12H2,1H3 |
| InChIKey | LDORKLHQZODKGY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|