C10H13BrN2 — CID 117199956
1-(4-bromo-2,3-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 117199956) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dihydro-1H-indol-3-yl)ethanamine.
| Compound Name | 1-(4-bromo-2,3-dihydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 117199956 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-(4-bromo-2,3-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | CC(N)C1CNc2cccc(Br)c21 |
| InChI | InChI=1S/C10H13BrN2/c1-6(12)7-5-13-9-4-2-3-8(11)10(7)9/h2-4,6-7,13H,5,12H2,1H3 |
| InChIKey | ZTFXAFRXHOKYNP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |