C12H17ClN2 — CID 117200097
(4-chloro-1-propan-2-yl-2,3-dihydroindol-3-yl)methanamine (PubChem CID 117200097) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is (4-chloro-1-propan-2-yl-2,3-dihydroindol-3-yl)methanamine.
| Compound Name | (4-chloro-1-propan-2-yl-2,3-dihydroindol-3-yl)methanamine |
|---|---|
| PubChem CID | 117200097 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (4-chloro-1-propan-2-yl-2,3-dihydroindol-3-yl)methanamine |
| SMILES | CC(C)N1CC(CN)c2c(Cl)cccc21 |
| InChI | InChI=1S/C12H17ClN2/c1-8(2)15-7-9(6-14)12-10(13)4-3-5-11(12)15/h3-5,8-9H,6-7,14H2,1-2H3 |
| InChIKey | IEDIPFKXYNBRAN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |