About 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine
1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine (PubChem CID 117200321) has the molecular formula C11H15NOS
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine |
| PubChem CID | 117200321 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNCC1CSc2cccc(OC)c21 |
| InChI | InChI=1S/C11H15NOS/c1-12-6-8-7-14-10-5-3-4-9(13-2)11(8)10/h3-5,8,12H,6-7H2,1-2H3 |
| InChIKey | XXXQGBYRGNZFFK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine?
The IUPAC name of 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine (CID 117200321) is 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine?
The canonical SMILES for 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine is CNCC1CSc2cccc(OC)c21.
What is the InChIKey of 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine?
The InChIKey is XXXQGBYRGNZFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS/c1-12-6-8-7-14-10-5-3-4-9(13-2)11(8)10/h3-5,8,12H,6-7H2,1-2H3.
What are the key properties of 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine?
1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine has a molecular weight of 209.31 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-2,3-dihydro-1-benzothiophen-3-yl)-N-methylmethanamine is sourced from PubChem (CID 117200321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).