C12H18N2O — CID 117200414
3-(3-aminopropyl)-1-methyl-2,3-dihydroindol-4-ol (PubChem CID 117200414) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-methyl-2,3-dihydroindol-4-ol.
| Compound Name | 3-(3-aminopropyl)-1-methyl-2,3-dihydroindol-4-ol |
|---|---|
| PubChem CID | 117200414 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(3-aminopropyl)-1-methyl-2,3-dihydroindol-4-ol |
| SMILES | CN1CC(CCCN)c2c(O)cccc21 |
| InChI | InChI=1S/C12H18N2O/c1-14-8-9(4-3-7-13)12-10(14)5-2-6-11(12)15/h2,5-6,9,15H,3-4,7-8,13H2,1H3 |
| InChIKey | KOSGAJLONYRJJR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |