About 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol
1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol (PubChem CID 117202027) has the molecular formula C11H13FOS
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol |
| PubChem CID | 117202027 |
| Molecular Formula | C11H13FOS |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol |
| SMILES | CC(O)CC1CSc2ccc(F)cc21 |
| InChI | InChI=1S/C11H13FOS/c1-7(13)4-8-6-14-11-3-2-9(12)5-10(8)11/h2-3,5,7-8,13H,4,6H2,1H3 |
| InChIKey | QMMYMTYVJWTXET-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol?
The IUPAC name of 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol (CID 117202027) is 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol.
What is the SMILES notation for 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol?
The canonical SMILES for 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol is CC(O)CC1CSc2ccc(F)cc21.
What is the InChIKey of 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol?
The InChIKey is QMMYMTYVJWTXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FOS/c1-7(13)4-8-6-14-11-3-2-9(12)5-10(8)11/h2-3,5,7-8,13H,4,6H2,1H3.
What are the key properties of 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol?
1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol has a molecular weight of 212.29 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)propan-2-ol is sourced from PubChem (CID 117202027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).