C10H11FOS — CID 117202042
1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol (PubChem CID 117202042) has the molecular formula C10H11FOS and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol.
| Compound Name | 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 117202042 |
| Molecular Formula | C10H11FOS |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 1-(5-fluoro-2,3-dihydro-1-benzothiophen-3-yl)ethanol |
| SMILES | CC(O)C1CSc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FOS/c1-6(12)9-5-13-10-3-2-7(11)4-8(9)10/h2-4,6,9,12H,5H2,1H3 |
| InChIKey | ROTGBPOFMIUCOE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |