About O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine
O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine (PubChem CID 117202128) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine |
| PubChem CID | 117202128 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine |
| SMILES | NOCC1CNc2ccc(F)cc21 |
| InChI | InChI=1S/C9H11FN2O/c10-7-1-2-9-8(3-7)6(4-12-9)5-13-11/h1-3,6,12H,4-5,11H2 |
| InChIKey | BDBZDINMVIAIBO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine?
The IUPAC name of O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine (CID 117202128) is O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine is NOCC1CNc2ccc(F)cc21.
What is the InChIKey of O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine?
The InChIKey is BDBZDINMVIAIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c10-7-1-2-9-8(3-7)6(4-12-9)5-13-11/h1-3,6,12H,4-5,11H2.
What are the key properties of O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine?
O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine has a molecular weight of 182.20 g/mol, XLogP of 1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(5-fluoro-2,3-dihydro-1H-indol-3-yl)methyl]hydroxylamine is sourced from PubChem (CID 117202128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).