About 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid
3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid (PubChem CID 117202167) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 117202167 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CC1CNc2ccc(Br)cc21)C(=O)O |
| InChI | InChI=1S/C13H16BrNO2/c1-13(2,12(16)17)6-8-7-15-11-4-3-9(14)5-10(8)11/h3-5,8,15H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | HPROZQHHDRGOJK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid (CID 117202167) is 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid is CC(C)(CC1CNc2ccc(Br)cc21)C(=O)O.
What is the InChIKey of 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid?
The InChIKey is HPROZQHHDRGOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-13(2,12(16)17)6-8-7-15-11-4-3-9(14)5-10(8)11/h3-5,8,15H,6-7H2,1-2H3,(H,16,17).
What are the key properties of 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid?
3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid has a molecular weight of 298.18 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2,3-dihydro-1H-indol-3-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117202167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).