About 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol
3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol (PubChem CID 117202373) has the molecular formula C9H11NO4S
and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol.
Molecular Properties
| Compound Name | 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol |
| PubChem CID | 117202373 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol |
| SMILES | NOCC1CS(=O)(=O)c2ccc(O)cc21 |
| InChI | InChI=1S/C9H11NO4S/c10-14-4-6-5-15(12,13)9-2-1-7(11)3-8(6)9/h1-3,6,11H,4-5,10H2 |
| InChIKey | FOEGDXNAXHQXHS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol?
The IUPAC name of 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol (CID 117202373) is 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol.
What is the SMILES notation for 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol?
The canonical SMILES for 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol is NOCC1CS(=O)(=O)c2ccc(O)cc21.
What is the InChIKey of 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol?
The InChIKey is FOEGDXNAXHQXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4S/c10-14-4-6-5-15(12,13)9-2-1-7(11)3-8(6)9/h1-3,6,11H,4-5,10H2.
What are the key properties of 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol?
3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol has a molecular weight of 229.26 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminooxymethyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-ol is sourced from PubChem (CID 117202373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).