About 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde
1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde (PubChem CID 117202549) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde |
| PubChem CID | 117202549 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde |
| SMILES | CCN1CC(C=O)c2cc(O)ccc21 |
| InChI | InChI=1S/C11H13NO2/c1-2-12-6-8(7-13)10-5-9(14)3-4-11(10)12/h3-5,7-8,14H,2,6H2,1H3 |
| InChIKey | IQMUZKCRFKVOST-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde?
The IUPAC name of 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde (CID 117202549) is 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde.
What is the SMILES notation for 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde?
The canonical SMILES for 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde is CCN1CC(C=O)c2cc(O)ccc21.
What is the InChIKey of 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde?
The InChIKey is IQMUZKCRFKVOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-12-6-8(7-13)10-5-9(14)3-4-11(10)12/h3-5,7-8,14H,2,6H2,1H3.
What are the key properties of 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde?
1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde has a molecular weight of 191.23 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-hydroxy-2,3-dihydroindole-3-carbaldehyde is sourced from PubChem (CID 117202549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).