C14H21NO — CID 117203210
1-(2-methyl-1-propan-2-yl-2,3-dihydroindol-5-yl)ethanol (PubChem CID 117203210) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(2-methyl-1-propan-2-yl-2,3-dihydroindol-5-yl)ethanol.
| Compound Name | 1-(2-methyl-1-propan-2-yl-2,3-dihydroindol-5-yl)ethanol |
|---|---|
| PubChem CID | 117203210 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-(2-methyl-1-propan-2-yl-2,3-dihydroindol-5-yl)ethanol |
| SMILES | CC(O)c1ccc2c(c1)CC(C)N2C(C)C |
| InChI | InChI=1S/C14H21NO/c1-9(2)15-10(3)7-13-8-12(11(4)16)5-6-14(13)15/h5-6,8-11,16H,7H2,1-4H3 |
| InChIKey | FOAICHRIQANJKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|