About N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine
N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine (PubChem CID 117203804) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine |
| PubChem CID | 117203804 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine |
| SMILES | CNCCCc1ccc2c(c1)SCC2C |
| InChI | InChI=1S/C13H19NS/c1-10-9-15-13-8-11(4-3-7-14-2)5-6-12(10)13/h5-6,8,10,14H,3-4,7,9H2,1-2H3 |
| InChIKey | XREQUBJCJBUOEF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine?
The IUPAC name of N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine (CID 117203804) is N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine.
What is the SMILES notation for N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine?
The canonical SMILES for N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine is CNCCCc1ccc2c(c1)SCC2C.
What is the InChIKey of N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine?
The InChIKey is XREQUBJCJBUOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS/c1-10-9-15-13-8-11(4-3-7-14-2)5-6-12(10)13/h5-6,8,10,14H,3-4,7,9H2,1-2H3.
What are the key properties of N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine?
N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine has a molecular weight of 221.37 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(3-methyl-2,3-dihydro-1-benzothiophen-6-yl)propan-1-amine is sourced from PubChem (CID 117203804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).