C9H16FN — CID 117205575
5-(fluoromethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 117205575) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 5-(fluoromethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-(fluoromethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 117205575 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 5-(fluoromethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)N1CCC=C(CF)C1 |
| InChI | InChI=1S/C9H16FN/c1-8(2)11-5-3-4-9(6-10)7-11/h4,8H,3,5-7H2,1-2H3 |
| InChIKey | ALYBHWROWGOTGM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|