About (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol
(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol (PubChem CID 117205596) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol.
Molecular Properties
| Compound Name | (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol |
| PubChem CID | 117205596 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol |
| SMILES | CCN1CCC=C(CS)C1 |
| InChI | InChI=1S/C8H15NS/c1-2-9-5-3-4-8(6-9)7-10/h4,10H,2-3,5-7H2,1H3 |
| InChIKey | CIPXBKAZPJJQKK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol?
The IUPAC name of (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol (CID 117205596) is (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol.
What is the SMILES notation for (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol?
The canonical SMILES for (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol is CCN1CCC=C(CS)C1.
What is the InChIKey of (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol?
The InChIKey is CIPXBKAZPJJQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-2-9-5-3-4-8(6-9)7-10/h4,10H,2-3,5-7H2,1H3.
What are the key properties of (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol?
(1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol has a molecular weight of 157.28 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanethiol is sourced from PubChem (CID 117205596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).