C10H19NO — CID 117205619
2-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)ethanol (PubChem CID 117205619) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)ethanol.
| Compound Name | 2-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)ethanol |
|---|---|
| PubChem CID | 117205619 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)ethanol |
| SMILES | CC(C)N1CC=C(CCO)CC1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)11-6-3-10(4-7-11)5-8-12/h3,9,12H,4-8H2,1-2H3 |
| InChIKey | WVNVHHDIPBVZII-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|