About 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal
3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal (PubChem CID 117205683) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal.
Molecular Properties
| Compound Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal |
| PubChem CID | 117205683 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal |
| SMILES | CC(C)N1CC=C(CCC=O)CC1 |
| InChI | InChI=1S/C11H19NO/c1-10(2)12-7-5-11(6-8-12)4-3-9-13/h5,9-10H,3-4,6-8H2,1-2H3 |
| InChIKey | XVCSDABPAXNELX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal?
The IUPAC name of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal (CID 117205683) is 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal.
What is the SMILES notation for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal?
The canonical SMILES for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal is CC(C)N1CC=C(CCC=O)CC1.
What is the InChIKey of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal?
The InChIKey is XVCSDABPAXNELX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2)12-7-5-11(6-8-12)4-3-9-13/h5,9-10H,3-4,6-8H2,1-2H3.
What are the key properties of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal?
3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal has a molecular weight of 181.28 g/mol, XLogP of 2.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)propanal is sourced from PubChem (CID 117205683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).