C9H18N2 — CID 117205877
N-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-2-amine (PubChem CID 117205877) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-2-amine.
| Compound Name | N-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 117205877 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-methyl-1-(1,2,3,6-tetrahydropyridin-5-yl)propan-2-amine |
| SMILES | CNC(C)CC1=CCCNC1 |
| InChI | InChI=1S/C9H18N2/c1-8(10-2)6-9-4-3-5-11-7-9/h4,8,10-11H,3,5-7H2,1-2H3 |
| InChIKey | ZINCBLDZDOWBSR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|