About 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid
3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid (PubChem CID 117205921) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid |
| PubChem CID | 117205921 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid |
| SMILES | CC(C)N1CCC=C(CCC(=O)O)C1 |
| InChI | InChI=1S/C11H19NO2/c1-9(2)12-7-3-4-10(8-12)5-6-11(13)14/h4,9H,3,5-8H2,1-2H3,(H,13,14) |
| InChIKey | TXVSKIYETSUMTH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid?
The IUPAC name of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid (CID 117205921) is 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid.
What is the SMILES notation for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid?
The canonical SMILES for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid is CC(C)N1CCC=C(CCC(=O)O)C1.
What is the InChIKey of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid?
The InChIKey is TXVSKIYETSUMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-9(2)12-7-3-4-10(8-12)5-6-11(13)14/h4,9H,3,5-8H2,1-2H3,(H,13,14).
What are the key properties of 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid?
3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid has a molecular weight of 197.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propanoic acid is sourced from PubChem (CID 117205921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).