About O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine
O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine (PubChem CID 117205964) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine |
| PubChem CID | 117205964 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine |
| SMILES | CN1CC=C(CON)CC1 |
| InChI | InChI=1S/C7H14N2O/c1-9-4-2-7(3-5-9)6-10-8/h2H,3-6,8H2,1H3 |
| InChIKey | GGWVXKAFZFWFJH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine?
The IUPAC name of O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine (CID 117205964) is O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine is CN1CC=C(CON)CC1.
What is the InChIKey of O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine?
The InChIKey is GGWVXKAFZFWFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-9-4-2-7(3-5-9)6-10-8/h2H,3-6,8H2,1H3.
What are the key properties of O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine?
O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine has a molecular weight of 142.20 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]hydroxylamine is sourced from PubChem (CID 117205964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).