C14H18N2O2 — CID 117206936
3-cyclohexyl-7-methoxy-1H-benzimidazol-2-one (PubChem CID 117206936) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-cyclohexyl-7-methoxy-1H-benzimidazol-2-one.
| Compound Name | 3-cyclohexyl-7-methoxy-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117206936 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-cyclohexyl-7-methoxy-1H-benzimidazol-2-one |
| SMILES | COc1cccc2c1[nH]c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C14H18N2O2/c1-18-12-9-5-8-11-13(12)15-14(17)16(11)10-6-3-2-4-7-10/h5,8-10H,2-4,6-7H2,1H3,(H,15,17) |
| InChIKey | RLROJZLGERDRIQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |