C23H24N10O4S — CID 11720787
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]urea (PubChem CID 11720787) has the molecular formula C23H24N10O4S and a molecular weight of 536.58 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]urea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 11720787 |
| Molecular Formula | C23H24N10O4S |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]urea |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=O)Nc3nc4nn(C)cc4c4nc(-c5ccco5)nn34)cc2)CC1 |
| InChI | InChI=1S/C23H24N10O4S/c1-30-9-11-32(12-10-30)38(35,36)16-7-5-15(6-8-16)24-23(34)27-22-26-19-17(14-31(2)28-19)21-25-20(29-33(21)22)18-4-3-13-37-18/h3-8,13-14H,9-12H2,1-2H3,(H2,24,26,27,28,34) |
| InChIKey | GWEQPTIJFKQSAQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |