About 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione
5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione (PubChem CID 117209751) has the molecular formula C12H15N3OS
and a molecular weight of 249.34 g/mol. Its IUPAC name is 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 117209751 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2ccc(OC3CCNCC3)cc2[nH]1 |
| InChI | InChI=1S/C12H15N3OS/c17-12-14-10-2-1-9(7-11(10)15-12)16-8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2,(H2,14,15,17) |
| InChIKey | MAUDADOLGKLUQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione (CID 117209751) is 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione is S=c1[nH]c2ccc(OC3CCNCC3)cc2[nH]1.
What is the InChIKey of 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is MAUDADOLGKLUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3OS/c17-12-14-10-2-1-9(7-11(10)15-12)16-8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2,(H2,14,15,17).
What are the key properties of 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione?
5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 249.34 g/mol, XLogP of 2.36, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yloxy-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 117209751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).