C12H22N4 — CID 117209803
N'-(5-cyclohexyl-1H-pyrazol-4-yl)propane-1,3-diamine (PubChem CID 117209803) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N'-(5-cyclohexyl-1H-pyrazol-4-yl)propane-1,3-diamine.
| Compound Name | N'-(5-cyclohexyl-1H-pyrazol-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 117209803 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N'-(5-cyclohexyl-1H-pyrazol-4-yl)propane-1,3-diamine |
| SMILES | NCCCNc1cn[nH]c1C1CCCCC1 |
| InChI | InChI=1S/C12H22N4/c13-7-4-8-14-11-9-15-16-12(11)10-5-2-1-3-6-10/h9-10,14H,1-8,13H2,(H,15,16) |
| InChIKey | MHSAPLVDNAFYRU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|